Name | Octyl salicylate |
Synonyms | Sun screener Octyl salicylate CAPRYL SALICYLATE salicylateden-octyle octylo-hydroxybenzoate n-octylo-hydroxybenzoate N-Octyl o-hydroxybenzoate 2-hydroxy-benzoicacioctylester o-hydroxy-benzoicacioctylester 2-Hydroxybenzoic acid octyl ester Benzoicacid,2-hydroxy-,octylester Benzoic acid, o-hydroxy-, octyl ester Benzoic acid, 2-hydroxy-, octyl ester |
CAS | 6969-49-9 |
EINECS | 230-190-2 |
InChI | InChI=1/C15H22O3/c1-2-3-4-5-6-9-12-18-15(17)13-10-7-8-11-14(13)16/h7-8,10-11,16H,2-6,9,12H2,1H3 |
Molecular Formula | C15H22O3 |
Molar Mass | 250.33 |
Density | 1.1109 (rough estimate) |
Boling Point | 333.47°C (rough estimate) |
pKa | 8.16±0.30(Predicted) |
Storage Condition | 2-8°C |
Refractive Index | 1.5020 (estimate) |
NIST chemical information | information provided by: webbook.nist.gov (external link) |
EPA chemical substance information | information provided by: ofmpeb.epa.gov (external link) |
Use | is used to prevent ultraviolet rays from tanning the skin, sunburn and has a therapeutic effect on photosensitive dermatitis |